C33H31BrN2O6 — CID 19129226
[2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 6-bromo-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 19129226) has the molecular formula C33H31BrN2O6 and a molecular weight of 631.52 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 6-bromo-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 6-bromo-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19129226 |
| Molecular Formula | C33H31BrN2O6 |
| Molecular Weight | 631.52 g/mol |
| Exact Mass | 630.14 |
| IUPAC Name | [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 6-bromo-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4oc5cc(Br)ccc5c4C)ccc32)ccc1OCCC(C)C |
| InChI | InChI=1S/C33H31BrN2O6/c1-5-38-29-14-20(6-11-26(29)39-13-12-18(2)3)30-24-10-8-22(16-28(24)42-32(36)25(30)17-35)40-33(37)31-19(4)23-9-7-21(34)15-27(23)41-31/h6-11,14-16,18,30H,5,12-13,36H2,1-4H3 |
| InChIKey | AVADATVFJDDYMD-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.52 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|