C35H28N2O6 — CID 19128675
[2-amino-3-cyano-4-(3-methoxy-4-phenylmethoxyphenyl)-4H-chromen-7-yl] 3,5-dimethyl-1-benzofuran-2-carboxylate (PubChem CID 19128675) has the molecular formula C35H28N2O6 and a molecular weight of 572.62 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-methoxy-4-phenylmethoxyphenyl)-4H-chromen-7-yl] 3,5-dimethyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(3-methoxy-4-phenylmethoxyphenyl)-4H-chromen-7-yl] 3,5-dimethyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19128675 |
| Molecular Formula | C35H28N2O6 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | [2-amino-3-cyano-4-(3-methoxy-4-phenylmethoxyphenyl)-4H-chromen-7-yl] 3,5-dimethyl-1-benzofuran-2-carboxylate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4oc5ccc(C)cc5c4C)ccc32)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C35H28N2O6/c1-20-9-13-28-26(15-20)21(2)33(42-28)35(38)41-24-11-12-25-30(17-24)43-34(37)27(18-36)32(25)23-10-14-29(31(16-23)39-3)40-19-22-7-5-4-6-8-22/h4-17,32H,19,37H2,1-3H3 |
| InChIKey | CTNMYXXQJPUQGQ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|