C28H19F5N2O6 — CID 19124211
[2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentafluorophenoxy)acetate (PubChem CID 19124211) has the molecular formula C28H19F5N2O6 and a molecular weight of 574.46 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentafluorophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentafluorophenoxy)acetate |
|---|---|
| PubChem CID | 19124211 |
| Molecular Formula | C28H19F5N2O6 |
| Molecular Weight | 574.46 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | [2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentafluorophenoxy)acetate |
| SMILES | C=CCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4c(F)c(F)c(F)c(F)c4F)ccc32)cc1OC |
| InChI | InChI=1S/C28H19F5N2O6/c1-3-8-38-17-7-4-13(9-19(17)37-2)21-15-6-5-14(10-18(15)41-28(35)16(21)11-34)40-20(36)12-39-27-25(32)23(30)22(29)24(31)26(27)33/h3-7,9-10,21H,1,8,12,35H2,2H3 |
| InChIKey | PNZYHPCDEGINNF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|