C30H28N2O6 — CID 19124195
[2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2-(3,4-dimethylphenoxy)acetate (PubChem CID 19124195) has the molecular formula C30H28N2O6 and a molecular weight of 512.56 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2-(3,4-dimethylphenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2-(3,4-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 19124195 |
| Molecular Formula | C30H28N2O6 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | [2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 2-(3,4-dimethylphenoxy)acetate |
| SMILES | C=CCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4ccc(C)c(C)c4)ccc32)cc1OC |
| InChI | InChI=1S/C30H28N2O6/c1-5-12-35-25-11-7-20(14-27(25)34-4)29-23-10-9-22(15-26(23)38-30(32)24(29)16-31)37-28(33)17-36-21-8-6-18(2)19(3)13-21/h5-11,13-15,29H,1,12,17,32H2,2-4H3 |
| InChIKey | NYLIZAWHPSZGIG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|