C34H30N2O7 — CID 19126972
[2-amino-3-cyano-4-[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(4-methoxyphenoxy)acetate (PubChem CID 19126972) has the molecular formula C34H30N2O7 and a molecular weight of 578.62 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(4-methoxyphenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(4-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 19126972 |
| Molecular Formula | C34H30N2O7 |
| Molecular Weight | 578.62 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | [2-amino-3-cyano-4-[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(4-methoxyphenoxy)acetate |
| SMILES | COc1ccc(OCC(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(OCc3ccc(C)cc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C34H30N2O7/c1-21-4-6-22(7-5-21)19-41-29-15-8-23(16-31(29)39-3)33-27-14-13-26(17-30(27)43-34(36)28(33)18-35)42-32(37)20-40-25-11-9-24(38-2)10-12-25/h4-17,33H,19-20,36H2,1-3H3 |
| InChIKey | JBVWVDMEZFFNON-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|