C27H24N2O6S — CID 19124413
[2-amino-3-cyano-4-(4-methylsulfanylphenyl)-4H-chromen-7-yl] 3,4,5-trimethoxybenzoate (PubChem CID 19124413) has the molecular formula C27H24N2O6S and a molecular weight of 504.56 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-methylsulfanylphenyl)-4H-chromen-7-yl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-(4-methylsulfanylphenyl)-4H-chromen-7-yl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 19124413 |
| Molecular Formula | C27H24N2O6S |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | [2-amino-3-cyano-4-(4-methylsulfanylphenyl)-4H-chromen-7-yl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(SC)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H24N2O6S/c1-31-22-11-16(12-23(32-2)25(22)33-3)27(30)34-17-7-10-19-21(13-17)35-26(29)20(14-28)24(19)15-5-8-18(36-4)9-6-15/h5-13,24H,29H2,1-4H3 |
| InChIKey | PVTHXPMGXUJCLE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|