C38H30N2O5 — CID 19123175
[2-amino-3-cyano-4-(3-methoxy-4-phenylmethoxyphenyl)-4H-chromen-7-yl] 2,2-diphenylacetate (PubChem CID 19123175) has the molecular formula C38H30N2O5 and a molecular weight of 594.67 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-methoxy-4-phenylmethoxyphenyl)-4H-chromen-7-yl] 2,2-diphenylacetate.
| Compound Name | [2-amino-3-cyano-4-(3-methoxy-4-phenylmethoxyphenyl)-4H-chromen-7-yl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 19123175 |
| Molecular Formula | C38H30N2O5 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | [2-amino-3-cyano-4-(3-methoxy-4-phenylmethoxyphenyl)-4H-chromen-7-yl] 2,2-diphenylacetate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)C(c4ccccc4)c4ccccc4)ccc32)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C38H30N2O5/c1-42-34-21-28(17-20-32(34)43-24-25-11-5-2-6-12-25)36-30-19-18-29(22-33(30)45-37(40)31(36)23-39)44-38(41)35(26-13-7-3-8-14-26)27-15-9-4-10-16-27/h2-22,35-36H,24,40H2,1H3 |
| InChIKey | ZQUGUCVOIUVPBM-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|