C30H29ClN2O4 — CID 19120838
[2-amino-4-(4-tert-butylphenyl)-3-cyano-4H-chromen-7-yl] 2-(4-chloro-3,5-dimethylphenoxy)acetate (PubChem CID 19120838) has the molecular formula C30H29ClN2O4 and a molecular weight of 517.03 g/mol. Its IUPAC name is [2-amino-4-(4-tert-butylphenyl)-3-cyano-4H-chromen-7-yl] 2-(4-chloro-3,5-dimethylphenoxy)acetate.
| Compound Name | [2-amino-4-(4-tert-butylphenyl)-3-cyano-4H-chromen-7-yl] 2-(4-chloro-3,5-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 19120838 |
| Molecular Formula | C30H29ClN2O4 |
| Molecular Weight | 517.03 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | [2-amino-4-(4-tert-butylphenyl)-3-cyano-4H-chromen-7-yl] 2-(4-chloro-3,5-dimethylphenoxy)acetate |
| SMILES | Cc1cc(OCC(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(C(C)(C)C)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C30H29ClN2O4/c1-17-12-22(13-18(2)28(17)31)35-16-26(34)36-21-10-11-23-25(14-21)37-29(33)24(15-32)27(23)19-6-8-20(9-7-19)30(3,4)5/h6-14,27H,16,33H2,1-5H3 |
| InChIKey | RSHDCVNCBFVGAP-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.03 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|