C27H23ClN2O5 — CID 19125709
[2-amino-3-cyano-4-(4-ethoxyphenyl)-4H-chromen-7-yl] 2-(4-chloro-3-methylphenoxy)acetate (PubChem CID 19125709) has the molecular formula C27H23ClN2O5 and a molecular weight of 490.94 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-ethoxyphenyl)-4H-chromen-7-yl] 2-(4-chloro-3-methylphenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(4-ethoxyphenyl)-4H-chromen-7-yl] 2-(4-chloro-3-methylphenoxy)acetate |
|---|---|
| PubChem CID | 19125709 |
| Molecular Formula | C27H23ClN2O5 |
| Molecular Weight | 490.94 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | [2-amino-3-cyano-4-(4-ethoxyphenyl)-4H-chromen-7-yl] 2-(4-chloro-3-methylphenoxy)acetate |
| SMILES | CCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4ccc(Cl)c(C)c4)ccc32)cc1 |
| InChI | InChI=1S/C27H23ClN2O5/c1-3-32-18-6-4-17(5-7-18)26-21-10-8-20(13-24(21)35-27(30)22(26)14-29)34-25(31)15-33-19-9-11-23(28)16(2)12-19/h4-13,26H,3,15,30H2,1-2H3 |
| InChIKey | NYXNDNUVMPXCEW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.94 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|