C28H25FN2O7 — CID 19123466
[2-amino-3-cyano-4-(3,4,5-trimethoxyphenyl)-4H-chromen-7-yl] 2-(2-fluorophenoxy)propanoate (PubChem CID 19123466) has the molecular formula C28H25FN2O7 and a molecular weight of 520.51 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3,4,5-trimethoxyphenyl)-4H-chromen-7-yl] 2-(2-fluorophenoxy)propanoate.
| Compound Name | [2-amino-3-cyano-4-(3,4,5-trimethoxyphenyl)-4H-chromen-7-yl] 2-(2-fluorophenoxy)propanoate |
|---|---|
| PubChem CID | 19123466 |
| Molecular Formula | C28H25FN2O7 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | [2-amino-3-cyano-4-(3,4,5-trimethoxyphenyl)-4H-chromen-7-yl] 2-(2-fluorophenoxy)propanoate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)C(C)Oc4ccccc4F)ccc32)cc(OC)c1OC |
| InChI | InChI=1S/C28H25FN2O7/c1-15(36-21-8-6-5-7-20(21)29)28(32)37-17-9-10-18-22(13-17)38-27(31)19(14-30)25(18)16-11-23(33-2)26(35-4)24(12-16)34-3/h5-13,15,25H,31H2,1-4H3 |
| InChIKey | RACQNMOXXHJNPD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|