C23H17FN2O5 — CID 19122507
[2-amino-3-cyano-4-(furan-2-yl)-4H-chromen-7-yl] 2-(2-fluorophenoxy)propanoate (PubChem CID 19122507) has the molecular formula C23H17FN2O5 and a molecular weight of 420.40 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(furan-2-yl)-4H-chromen-7-yl] 2-(2-fluorophenoxy)propanoate.
| Compound Name | [2-amino-3-cyano-4-(furan-2-yl)-4H-chromen-7-yl] 2-(2-fluorophenoxy)propanoate |
|---|---|
| PubChem CID | 19122507 |
| Molecular Formula | C23H17FN2O5 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [2-amino-3-cyano-4-(furan-2-yl)-4H-chromen-7-yl] 2-(2-fluorophenoxy)propanoate |
| SMILES | CC(Oc1ccccc1F)C(=O)Oc1ccc2c(c1)OC(N)=C(C#N)C2c1ccco1 |
| InChI | InChI=1S/C23H17FN2O5/c1-13(29-18-6-3-2-5-17(18)24)23(27)30-14-8-9-15-20(11-14)31-22(26)16(12-25)21(15)19-7-4-10-28-19/h2-11,13,21H,26H2,1H3 |
| InChIKey | LACBAFILRQMJTM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|