C33H26Cl2N2O5 — CID 19126912
[2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(3,4-dimethylphenoxy)acetate (PubChem CID 19126912) has the molecular formula C33H26Cl2N2O5 and a molecular weight of 601.49 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(3,4-dimethylphenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(3,4-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 19126912 |
| Molecular Formula | C33H26Cl2N2O5 |
| Molecular Weight | 601.49 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | [2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 2-(3,4-dimethylphenoxy)acetate |
| SMILES | Cc1ccc(OCC(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2cccc(OCc3ccc(Cl)cc3Cl)c2)cc1C |
| InChI | InChI=1S/C33H26Cl2N2O5/c1-19-6-9-25(12-20(19)2)40-18-31(38)41-26-10-11-27-30(15-26)42-33(37)28(16-36)32(27)21-4-3-5-24(13-21)39-17-22-7-8-23(34)14-29(22)35/h3-15,32H,17-18,37H2,1-2H3 |
| InChIKey | MIKOUDGASLLQJB-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.49 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|