C33H21BrCl2N2O5 — CID 19129802
[2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 6-bromo-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 19129802) has the molecular formula C33H21BrCl2N2O5 and a molecular weight of 676.35 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 6-bromo-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 6-bromo-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19129802 |
| Molecular Formula | C33H21BrCl2N2O5 |
| Molecular Weight | 676.35 g/mol |
| Exact Mass | 674.00 |
| IUPAC Name | [2-amino-3-cyano-4-[3-[(2,4-dichlorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 6-bromo-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2cccc(OCc3ccc(Cl)cc3Cl)c2)oc2cc(Br)ccc12 |
| InChI | InChI=1S/C33H21BrCl2N2O5/c1-17-24-9-6-20(34)12-28(24)42-31(17)33(39)41-23-8-10-25-29(14-23)43-32(38)26(15-37)30(25)18-3-2-4-22(11-18)40-16-19-5-7-21(35)13-27(19)36/h2-14,30H,16,38H2,1H3 |
| InChIKey | IIONXVVNVMFPOG-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.35 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|