C31H21Cl3N2O5 — CID 19129694
[2-amino-4-[3-[(2-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-methoxybenzoate (PubChem CID 19129694) has the molecular formula C31H21Cl3N2O5 and a molecular weight of 607.88 g/mol. Its IUPAC name is [2-amino-4-[3-[(2-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-methoxybenzoate.
| Compound Name | [2-amino-4-[3-[(2-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-methoxybenzoate |
|---|---|
| PubChem CID | 19129694 |
| Molecular Formula | C31H21Cl3N2O5 |
| Molecular Weight | 607.88 g/mol |
| Exact Mass | 606.05 |
| IUPAC Name | [2-amino-4-[3-[(2-chlorophenyl)methoxy]phenyl]-3-cyano-4H-chromen-7-yl] 3,5-dichloro-4-methoxybenzoate |
| SMILES | COc1c(Cl)cc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2cccc(OCc3ccccc3Cl)c2)cc1Cl |
| InChI | InChI=1S/C31H21Cl3N2O5/c1-38-29-25(33)12-19(13-26(29)34)31(37)40-21-9-10-22-27(14-21)41-30(36)23(15-35)28(22)17-6-4-7-20(11-17)39-16-18-5-2-3-8-24(18)32/h2-14,28H,16,36H2,1H3 |
| InChIKey | UNOXUMDIXQPSEG-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.88 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|