C23H12Cl3N3O5 — CID 19124058
[2-amino-3-cyano-4-(2,6-dichlorophenyl)-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate (PubChem CID 19124058) has the molecular formula C23H12Cl3N3O5 and a molecular weight of 516.72 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2,6-dichlorophenyl)-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate.
| Compound Name | [2-amino-3-cyano-4-(2,6-dichlorophenyl)-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 19124058 |
| Molecular Formula | C23H12Cl3N3O5 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 514.98 |
| IUPAC Name | [2-amino-3-cyano-4-(2,6-dichlorophenyl)-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)c3cc([N+](=O)[O-])ccc3Cl)ccc2C1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H12Cl3N3O5/c24-16-7-4-11(29(31)32)8-14(16)23(30)33-12-5-6-13-19(9-12)34-22(28)15(10-27)20(13)21-17(25)2-1-3-18(21)26/h1-9,20H,28H2 |
| InChIKey | UANNEEPOJUQJJS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|