C22H13ClFN3O6S — CID 166597324
[2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 4-nitrobenzenesulfonate (PubChem CID 166597324) has the molecular formula C22H13ClFN3O6S and a molecular weight of 501.88 g/mol. Its IUPAC name is [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 4-nitrobenzenesulfonate.
| Compound Name | [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 166597324 |
| Molecular Formula | C22H13ClFN3O6S |
| Molecular Weight | 501.88 g/mol |
| Exact Mass | 501.02 |
| IUPAC Name | [2-amino-4-(2-chloro-6-fluorophenyl)-3-cyano-4H-chromen-7-yl] 4-nitrobenzenesulfonate |
| SMILES | N#CC1=C(N)Oc2cc(OS(=O)(=O)c3ccc([N+](=O)[O-])cc3)ccc2C1c1c(F)cccc1Cl |
| InChI | InChI=1S/C22H13ClFN3O6S/c23-17-2-1-3-18(24)21(17)20-15-9-6-13(10-19(15)32-22(26)16(20)11-25)33-34(30,31)14-7-4-12(5-8-14)27(28)29/h1-10,20H,26H2 |
| InChIKey | XEUJGPQMQPLRPW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.88 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|