C16H10ClFN2O2 — CID 8613693
(4S)-2-amino-4-(2-chloro-6-fluorophenyl)-7-hydroxy-4H-chromene-3-carbonitrile (PubChem CID 8613693) has the molecular formula C16H10ClFN2O2 and a molecular weight of 316.72 g/mol. Its IUPAC name is (4S)-2-amino-4-(2-chloro-6-fluorophenyl)-7-hydroxy-4H-chromene-3-carbonitrile.
| Compound Name | (4S)-2-amino-4-(2-chloro-6-fluorophenyl)-7-hydroxy-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 8613693 |
| Molecular Formula | C16H10ClFN2O2 |
| Molecular Weight | 316.72 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | (4S)-2-amino-4-(2-chloro-6-fluorophenyl)-7-hydroxy-4H-chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2cc(O)ccc2[C@@H]1c1c(F)cccc1Cl |
| InChI | InChI=1S/C16H10ClFN2O2/c17-11-2-1-3-12(18)15(11)14-9-5-4-8(21)6-13(9)22-16(20)10(14)7-19/h1-6,14,21H,20H2/t14-/m0/s1 |
| InChIKey | DLAMATKMXQJGDK-AWEZNQCLSA-N |
| XLogP | 3.40 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |