C24H16ClN3O5S — CID 19124458
[2-amino-3-cyano-4-(4-methylsulfanylphenyl)-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate (PubChem CID 19124458) has the molecular formula C24H16ClN3O5S and a molecular weight of 493.93 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-methylsulfanylphenyl)-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate.
| Compound Name | [2-amino-3-cyano-4-(4-methylsulfanylphenyl)-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 19124458 |
| Molecular Formula | C24H16ClN3O5S |
| Molecular Weight | 493.93 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | [2-amino-3-cyano-4-(4-methylsulfanylphenyl)-4H-chromen-7-yl] 2-chloro-5-nitrobenzoate |
| SMILES | CSc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cc([N+](=O)[O-])ccc4Cl)ccc32)cc1 |
| InChI | InChI=1S/C24H16ClN3O5S/c1-34-16-6-2-13(3-7-16)22-17-8-5-15(11-21(17)33-23(27)19(22)12-26)32-24(29)18-10-14(28(30)31)4-9-20(18)25/h2-11,22H,27H2,1H3 |
| InChIKey | UBTSHLQPFNFWCA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.93 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|