C16H15NO8S — CID 88741535
(5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl 5-hydroxy-2-methylbenzenesulfonate (PubChem CID 88741535) has the molecular formula C16H15NO8S and a molecular weight of 381.36 g/mol. Its IUPAC name is (5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl 5-hydroxy-2-methylbenzenesulfonate.
| Compound Name | (5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl 5-hydroxy-2-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88741535 |
| Molecular Formula | C16H15NO8S |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | (5-nitro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl 5-hydroxy-2-methylbenzenesulfonate |
| SMILES | Cc1ccc(O)cc1S(=O)(=O)OCC1COc2cccc([N+](=O)[O-])c2O1 |
| InChI | InChI=1S/C16H15NO8S/c1-10-5-6-11(18)7-15(10)26(21,22)24-9-12-8-23-14-4-2-3-13(17(19)20)16(14)25-12/h2-7,12,18H,8-9H2,1H3 |
| InChIKey | CWTDTFRGPTWKOF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|