C18H19N3O5 — CID 51537803
N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-(2-nitroanilino)propanamide (PubChem CID 51537803) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-(2-nitroanilino)propanamide.
| Compound Name | N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-(2-nitroanilino)propanamide |
|---|---|
| PubChem CID | 51537803 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3-(2-nitroanilino)propanamide |
| SMILES | O=C(CCNc1ccccc1[N+](=O)[O-])NC[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C18H19N3O5/c22-18(9-10-19-14-5-1-2-6-15(14)21(23)24)20-11-13-12-25-16-7-3-4-8-17(16)26-13/h1-8,13,19H,9-12H2,(H,20,22)/t13-/m0/s1 |
| InChIKey | BJJROPLYUBGFLA-ZDUSSCGKSA-N |
| XLogP | 2.35 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|