C16H22N4O5 — CID 97014333
(2R,5R)-5-[[4-(2-nitroanilino)butanoylamino]methyl]oxolane-2-carboxamide (PubChem CID 97014333) has the molecular formula C16H22N4O5 and a molecular weight of 350.38 g/mol. Its IUPAC name is (2R,5R)-5-[[4-(2-nitroanilino)butanoylamino]methyl]oxolane-2-carboxamide.
| Compound Name | (2R,5R)-5-[[4-(2-nitroanilino)butanoylamino]methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 97014333 |
| Molecular Formula | C16H22N4O5 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (2R,5R)-5-[[4-(2-nitroanilino)butanoylamino]methyl]oxolane-2-carboxamide |
| SMILES | NC(=O)[C@H]1CC[C@H](CNC(=O)CCCNc2ccccc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C16H22N4O5/c17-16(22)14-8-7-11(25-14)10-19-15(21)6-3-9-18-12-4-1-2-5-13(12)20(23)24/h1-2,4-5,11,14,18H,3,6-10H2,(H2,17,22)(H,19,21)/t11-,14-/m1/s1 |
| InChIKey | VPZZTGPJNDAQLQ-BXUZGUMPSA-N |
| XLogP | 0.94 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|