About methane;[(2R)-1-nitropropan-2-yl] acetate;[(2R)-1-nitropropan-2-yl]oxymethylbenzene
methane;[(2R)-1-nitropropan-2-yl] acetate;[(2R)-1-nitropropan-2-yl]oxymethylbenzene (PubChem CID 163761543) has the molecular formula C17H30N2O7
and a molecular weight of 374.43 g/mol. Its IUPAC name is methane;[(2R)-1-nitropropan-2-yl] acetate;[(2R)-1-nitropropan-2-yl]oxymethylbenzene.
Molecular Properties
| Compound Name | methane;[(2R)-1-nitropropan-2-yl] acetate;[(2R)-1-nitropropan-2-yl]oxymethylbenzene |
| PubChem CID | 163761543 |
| Molecular Formula | C17H30N2O7 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | methane;[(2R)-1-nitropropan-2-yl] acetate;[(2R)-1-nitropropan-2-yl]oxymethylbenzene |
| SMILES | C.C.CC(=O)O[C@H](C)C[N+](=O)[O-].C[C@H](C[N+](=O)[O-])OCc1ccccc1 |
| InChI | InChI=1S/C10H13NO3.C5H9NO4.2CH4/c1-9(7-11(12)13)14-8-10-5-3-2-4-6-10;1-4(3-6(8)9)10-5(2)7;;/h2-6,9H,7-8H2,1H3;4H,3H2,1-2H3;2*1H4/t9-;4-;;/m11../s1 |
| InChIKey | LYPBBXORJRONJT-BRMRBICJSA-N |
| XLogP | 3.36 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;[(2R)-1-nitropropan-2-yl] acetate;[(2R)-1-nitropropan-2-yl]oxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;[(2R)-1-nitropropan-2-yl] acetate;[(2R)-1-nitropropan-2-yl]oxymethylbenzene?
The IUPAC name of methane;[(2R)-1-nitropropan-2-yl] acetate;[(2R)-1-nitropropan-2-yl]oxymethylbenzene (CID 163761543) is methane;[(2R)-1-nitropropan-2-yl] acetate;[(2R)-1-nitropropan-2-yl]oxymethylbenzene.
What is the SMILES notation for methane;[(2R)-1-nitropropan-2-yl] acetate;[(2R)-1-nitropropan-2-yl]oxymethylbenzene?
The canonical SMILES for methane;[(2R)-1-nitropropan-2-yl] acetate;[(2R)-1-nitropropan-2-yl]oxymethylbenzene is C.C.CC(=O)O[C@H](C)C[N+](=O)[O-].C[C@H](C[N+](=O)[O-])OCc1ccccc1.
What is the InChIKey of methane;[(2R)-1-nitropropan-2-yl] acetate;[(2R)-1-nitropropan-2-yl]oxymethylbenzene?
The InChIKey is LYPBBXORJRONJT-BRMRBICJSA-N. The full InChI is InChI=1S/C10H13NO3.C5H9NO4.2CH4/c1-9(7-11(12)13)14-8-10-5-3-2-4-6-10;1-4(3-6(8)9)10-5(2)7;;/h2-6,9H,7-8H2,1H3;4H,3H2,1-2H3;2*1H4/t9-;4-;;/m11../s1.
What are the key properties of methane;[(2R)-1-nitropropan-2-yl] acetate;[(2R)-1-nitropropan-2-yl]oxymethylbenzene?
methane;[(2R)-1-nitropropan-2-yl] acetate;[(2R)-1-nitropropan-2-yl]oxymethylbenzene has a molecular weight of 374.43 g/mol, XLogP of 3.36, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methane;[(2R)-1-nitropropan-2-yl] acetate;[(2R)-1-nitropropan-2-yl]oxymethylbenzene is sourced from PubChem (CID 163761543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).