C17H18N2O8 — CID 71407886
3,5-dinitrobenzoic acid;(2R)-2-phenylmethoxypropan-1-ol (PubChem CID 71407886) has the molecular formula C17H18N2O8 and a molecular weight of 378.34 g/mol. Its IUPAC name is 3,5-dinitrobenzoic acid;(2R)-2-phenylmethoxypropan-1-ol.
| Compound Name | 3,5-dinitrobenzoic acid;(2R)-2-phenylmethoxypropan-1-ol |
|---|---|
| PubChem CID | 71407886 |
| Molecular Formula | C17H18N2O8 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 3,5-dinitrobenzoic acid;(2R)-2-phenylmethoxypropan-1-ol |
| SMILES | C[C@H](CO)OCc1ccccc1.O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H14O2.C7H4N2O6/c1-9(7-11)12-8-10-5-3-2-4-6-10;10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h2-6,9,11H,7-8H2,1H3;1-3H,(H,10,11)/t9-;/m1./s1 |
| InChIKey | LQNKNIZHWCTBQX-SBSPUUFOSA-N |
| XLogP | 2.79 |
| TPSA | 153.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|