C25H30O7 — CID 10366066
methyl (E,4S,5S,6R)-4-acetyloxy-6-(2,3-dimethoxyphenyl)-5-methyl-6-phenylmethoxyhex-2-enoate (PubChem CID 10366066) has the molecular formula C25H30O7 and a molecular weight of 442.51 g/mol. Its IUPAC name is methyl (E,4S,5S,6R)-4-acetyloxy-6-(2,3-dimethoxyphenyl)-5-methyl-6-phenylmethoxyhex-2-enoate.
| Compound Name | methyl (E,4S,5S,6R)-4-acetyloxy-6-(2,3-dimethoxyphenyl)-5-methyl-6-phenylmethoxyhex-2-enoate |
|---|---|
| PubChem CID | 10366066 |
| Molecular Formula | C25H30O7 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | methyl (E,4S,5S,6R)-4-acetyloxy-6-(2,3-dimethoxyphenyl)-5-methyl-6-phenylmethoxyhex-2-enoate |
| SMILES | COC(=O)/C=C/[C@H](OC(C)=O)[C@H](C)[C@@H](OCc1ccccc1)c1cccc(OC)c1OC |
| InChI | InChI=1S/C25H30O7/c1-17(21(32-18(2)26)14-15-23(27)29-4)24(31-16-19-10-7-6-8-11-19)20-12-9-13-22(28-3)25(20)30-5/h6-15,17,21,24H,16H2,1-5H3/b15-14+/t17-,21-,24+/m0/s1 |
| InChIKey | JJCPPIGBNHCYKE-BWGMQTQQSA-N |
| XLogP | 4.26 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|