C19H21NO3 — CID 177471593
methyl (E,4R)-4-(benzylamino)-4-(2-methoxyphenyl)but-2-enoate (PubChem CID 177471593) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is methyl (E,4R)-4-(benzylamino)-4-(2-methoxyphenyl)but-2-enoate.
| Compound Name | methyl (E,4R)-4-(benzylamino)-4-(2-methoxyphenyl)but-2-enoate |
|---|---|
| PubChem CID | 177471593 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | methyl (E,4R)-4-(benzylamino)-4-(2-methoxyphenyl)but-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H](NCc1ccccc1)c1ccccc1OC |
| InChI | InChI=1S/C19H21NO3/c1-22-18-11-7-6-10-16(18)17(12-13-19(21)23-2)20-14-15-8-4-3-5-9-15/h3-13,17,20H,14H2,1-2H3/b13-12+/t17-/m1/s1 |
| InChIKey | OKXLRXWFBJDWRB-GZKZCVOOSA-N |
| XLogP | 3.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|