About N-benzyl-1-phenylmethanamine;1-methoxy-2-[1-(2-methoxyphenyl)propyl]benzene
N-benzyl-1-phenylmethanamine;1-methoxy-2-[1-(2-methoxyphenyl)propyl]benzene (PubChem CID 70442931) has the molecular formula C31H35NO2
and a molecular weight of 453.63 g/mol. Its IUPAC name is N-benzyl-1-phenylmethanamine;1-methoxy-2-[1-(2-methoxyphenyl)propyl]benzene.
Molecular Properties
| Compound Name | N-benzyl-1-phenylmethanamine;1-methoxy-2-[1-(2-methoxyphenyl)propyl]benzene |
| PubChem CID | 70442931 |
| Molecular Formula | C31H35NO2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | N-benzyl-1-phenylmethanamine;1-methoxy-2-[1-(2-methoxyphenyl)propyl]benzene |
| SMILES | CCC(c1ccccc1OC)c1ccccc1OC.c1ccc(CNCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H20O2.C14H15N/c1-4-13(14-9-5-7-11-16(14)18-2)15-10-6-8-12-17(15)19-3;1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14/h5-13H,4H2,1-3H3;1-10,15H,11-12H2 |
| InChIKey | PCIAFONPAVAMMI-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-1-phenylmethanamine;1-methoxy-2-[1-(2-methoxyphenyl)propyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1-phenylmethanamine;1-methoxy-2-[1-(2-methoxyphenyl)propyl]benzene?
The IUPAC name of N-benzyl-1-phenylmethanamine;1-methoxy-2-[1-(2-methoxyphenyl)propyl]benzene (CID 70442931) is N-benzyl-1-phenylmethanamine;1-methoxy-2-[1-(2-methoxyphenyl)propyl]benzene.
What is the SMILES notation for N-benzyl-1-phenylmethanamine;1-methoxy-2-[1-(2-methoxyphenyl)propyl]benzene?
The canonical SMILES for N-benzyl-1-phenylmethanamine;1-methoxy-2-[1-(2-methoxyphenyl)propyl]benzene is CCC(c1ccccc1OC)c1ccccc1OC.c1ccc(CNCc2ccccc2)cc1.
What is the InChIKey of N-benzyl-1-phenylmethanamine;1-methoxy-2-[1-(2-methoxyphenyl)propyl]benzene?
The InChIKey is PCIAFONPAVAMMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O2.C14H15N/c1-4-13(14-9-5-7-11-16(14)18-2)15-10-6-8-12-17(15)19-3;1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14/h5-13H,4H2,1-3H3;1-10,15H,11-12H2.
What are the key properties of N-benzyl-1-phenylmethanamine;1-methoxy-2-[1-(2-methoxyphenyl)propyl]benzene?
N-benzyl-1-phenylmethanamine;1-methoxy-2-[1-(2-methoxyphenyl)propyl]benzene has a molecular weight of 453.63 g/mol, XLogP of 7.22, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1-phenylmethanamine;1-methoxy-2-[1-(2-methoxyphenyl)propyl]benzene is sourced from PubChem (CID 70442931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).