C15H18O — CID 22555819
1-(1-cyclopenta-1,4-dien-1-ylpropyl)-2-methoxybenzene (PubChem CID 22555819) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-(1-cyclopenta-1,4-dien-1-ylpropyl)-2-methoxybenzene.
| Compound Name | 1-(1-cyclopenta-1,4-dien-1-ylpropyl)-2-methoxybenzene |
|---|---|
| PubChem CID | 22555819 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 1-(1-cyclopenta-1,4-dien-1-ylpropyl)-2-methoxybenzene |
| SMILES | CCC(C1=CCC=C1)c1ccccc1OC |
| InChI | InChI=1S/C15H18O/c1-3-13(12-8-4-5-9-12)14-10-6-7-11-15(14)16-2/h4,6-11,13H,3,5H2,1-2H3 |
| InChIKey | YUXJWAQJVPZADG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |