C16H18O — CID 102102703
1-(1-cyclopenta-1,4-dien-1-ylbut-3-enyl)-2-methoxybenzene (PubChem CID 102102703) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-(1-cyclopenta-1,4-dien-1-ylbut-3-enyl)-2-methoxybenzene.
| Compound Name | 1-(1-cyclopenta-1,4-dien-1-ylbut-3-enyl)-2-methoxybenzene |
|---|---|
| PubChem CID | 102102703 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 1-(1-cyclopenta-1,4-dien-1-ylbut-3-enyl)-2-methoxybenzene |
| SMILES | C=CCC(C1=CCC=C1)c1ccccc1OC |
| InChI | InChI=1S/C16H18O/c1-3-8-14(13-9-4-5-10-13)15-11-6-7-12-16(15)17-2/h3-4,6-7,9-12,14H,1,5,8H2,2H3 |
| InChIKey | DJQJBSOTCYYQBA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|