C20H23NO2 — CID 100926536
[(1S)-1-phenylethyl] (E,4R)-4-(benzylamino)pent-2-enoate (PubChem CID 100926536) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] (E,4R)-4-(benzylamino)pent-2-enoate.
| Compound Name | [(1S)-1-phenylethyl] (E,4R)-4-(benzylamino)pent-2-enoate |
|---|---|
| PubChem CID | 100926536 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | [(1S)-1-phenylethyl] (E,4R)-4-(benzylamino)pent-2-enoate |
| SMILES | C[C@H](/C=C/C(=O)O[C@@H](C)c1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C20H23NO2/c1-16(21-15-18-9-5-3-6-10-18)13-14-20(22)23-17(2)19-11-7-4-8-12-19/h3-14,16-17,21H,15H2,1-2H3/b14-13+/t16-,17+/m1/s1 |
| InChIKey | WRYDJZQVVHKKPC-KGWAOHPJSA-N |
| XLogP | 4.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|