C15H18O2 — CID 24895615
[(E)-3,3-bis(prop-2-enoxy)prop-1-enyl]benzene (PubChem CID 24895615) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is [(E)-3,3-bis(prop-2-enoxy)prop-1-enyl]benzene.
| Compound Name | [(E)-3,3-bis(prop-2-enoxy)prop-1-enyl]benzene |
|---|---|
| PubChem CID | 24895615 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | [(E)-3,3-bis(prop-2-enoxy)prop-1-enyl]benzene |
| SMILES | C=CCOC(/C=C/c1ccccc1)OCC=C |
| InChI | InChI=1S/C15H18O2/c1-3-12-16-15(17-13-4-2)11-10-14-8-6-5-7-9-14/h3-11,15H,1-2,12-13H2/b11-10+ |
| InChIKey | XAKATUXJECCAPT-ZHACJKMWSA-N |
| XLogP | 3.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|