C13H17N — CID 11542895
(1E)-1-phenylhepta-1,6-dien-3-amine (PubChem CID 11542895) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (1E)-1-phenylhepta-1,6-dien-3-amine.
| Compound Name | (1E)-1-phenylhepta-1,6-dien-3-amine |
|---|---|
| PubChem CID | 11542895 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (1E)-1-phenylhepta-1,6-dien-3-amine |
| SMILES | C=CCCC(N)/C=C/c1ccccc1 |
| InChI | InChI=1S/C13H17N/c1-2-3-9-13(14)11-10-12-7-5-4-6-8-12/h2,4-8,10-11,13H,1,3,9,14H2/b11-10+ |
| InChIKey | SAZIERPNXGIPMH-ZHACJKMWSA-N |
| XLogP | 2.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|