C16H17N — CID 77474481
1,4-diphenylbut-3-en-2-amine (PubChem CID 77474481) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is 1,4-diphenylbut-3-en-2-amine.
| Compound Name | 1,4-diphenylbut-3-en-2-amine |
|---|---|
| PubChem CID | 77474481 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1,4-diphenylbut-3-en-2-amine |
| SMILES | NC(C=Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C16H17N/c17-16(13-15-9-5-2-6-10-15)12-11-14-7-3-1-4-8-14/h1-12,16H,13,17H2 |
| InChIKey | JXVUEVNIKJJONX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |