About 3-phenylprop-2-ene-1,1-diol
3-phenylprop-2-ene-1,1-diol (PubChem CID 54432533) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 3-phenylprop-2-ene-1,1-diol.
Molecular Properties
| Compound Name | 3-phenylprop-2-ene-1,1-diol |
| PubChem CID | 54432533 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 3-phenylprop-2-ene-1,1-diol |
| SMILES | OC(O)C=Cc1ccccc1 |
| InChI | InChI=1S/C9H10O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7,9-11H |
| InChIKey | WIMHGKDTXQGFLJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylprop-2-ene-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylprop-2-ene-1,1-diol?
The IUPAC name of 3-phenylprop-2-ene-1,1-diol (CID 54432533) is 3-phenylprop-2-ene-1,1-diol.
What is the SMILES notation for 3-phenylprop-2-ene-1,1-diol?
The canonical SMILES for 3-phenylprop-2-ene-1,1-diol is OC(O)C=Cc1ccccc1.
What is the InChIKey of 3-phenylprop-2-ene-1,1-diol?
The InChIKey is WIMHGKDTXQGFLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7,9-11H.
What are the key properties of 3-phenylprop-2-ene-1,1-diol?
3-phenylprop-2-ene-1,1-diol has a molecular weight of 150.18 g/mol, XLogP of 1.01, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylprop-2-ene-1,1-diol is sourced from PubChem (CID 54432533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).