C20H30O2Si — CID 24886629
(5,5-dimethyl-6-phenylmethoxyoct-7-en-1-yn-3-yl)oxy-trimethylsilane (PubChem CID 24886629) has the molecular formula C20H30O2Si and a molecular weight of 330.54 g/mol. Its IUPAC name is (5,5-dimethyl-6-phenylmethoxyoct-7-en-1-yn-3-yl)oxy-trimethylsilane.
| Compound Name | (5,5-dimethyl-6-phenylmethoxyoct-7-en-1-yn-3-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 24886629 |
| Molecular Formula | C20H30O2Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (5,5-dimethyl-6-phenylmethoxyoct-7-en-1-yn-3-yl)oxy-trimethylsilane |
| SMILES | C#CC(CC(C)(C)C(C=C)OCc1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C20H30O2Si/c1-8-18(22-23(5,6)7)15-20(3,4)19(9-2)21-16-17-13-11-10-12-14-17/h1,9-14,18-19H,2,15-16H2,3-7H3 |
| InChIKey | RYFFRPLFRDUVBE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|