C27H46O2Si2 — CID 139993023
[(1R,2R,3S)-2-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenylhex-5-ynoxy]-tert-butyl-dimethylsilane (PubChem CID 139993023) has the molecular formula C27H46O2Si2 and a molecular weight of 458.84 g/mol. Its IUPAC name is [(1R,2R,3S)-2-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenylhex-5-ynoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2R,3S)-2-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenylhex-5-ynoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 139993023 |
| Molecular Formula | C27H46O2Si2 |
| Molecular Weight | 458.84 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | [(1R,2R,3S)-2-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenylhex-5-ynoxy]-tert-butyl-dimethylsilane |
| SMILES | C#CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](Cc1ccccc1)[C@@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H46O2Si2/c1-13-18-25(29-31(11,12)27(6,7)8)23(21-22-19-16-15-17-20-22)24(14-2)28-30(9,10)26(3,4)5/h1,14-17,19-20,23-25H,2,18,21H2,3-12H3/t23-,24+,25-/m0/s1 |
| InChIKey | PVAJEUDIDNFADW-GVAUOCQISA-N |
| XLogP | 7.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.84 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|