C29H50O5SSi2 — CID 101062938
[(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]hept-6-ynyl] 4-methylbenzenesulfonate (PubChem CID 101062938) has the molecular formula C29H50O5SSi2 and a molecular weight of 566.95 g/mol. Its IUPAC name is [(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]hept-6-ynyl] 4-methylbenzenesulfonate.
| Compound Name | [(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]hept-6-ynyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101062938 |
| Molecular Formula | C29H50O5SSi2 |
| Molecular Weight | 566.95 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | [(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]hept-6-ynyl] 4-methylbenzenesulfonate |
| SMILES | C#CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CCOS(=O)(=O)c1ccc(C)cc1)[C@@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H50O5SSi2/c1-14-16-27(34-37(12,13)29(7,8)9)25(26(15-2)33-36(10,11)28(4,5)6)21-22-32-35(30,31)24-19-17-23(3)18-20-24/h1,15,17-20,25-27H,2,16,21-22H2,3-13H3/t25-,26-,27-/m1/s1 |
| InChIKey | LMXIBEPSJFBIGZ-ZONZVBGPSA-N |
| XLogP | 7.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.95 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|