C26H39NO6SSi — CID 170520388
[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(phenylmethoxycarbonylamino)pentyl] 4-methylbenzenesulfonate (PubChem CID 170520388) has the molecular formula C26H39NO6SSi and a molecular weight of 521.75 g/mol. Its IUPAC name is [(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(phenylmethoxycarbonylamino)pentyl] 4-methylbenzenesulfonate.
| Compound Name | [(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(phenylmethoxycarbonylamino)pentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 170520388 |
| Molecular Formula | C26H39NO6SSi |
| Molecular Weight | 521.75 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | [(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(phenylmethoxycarbonylamino)pentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC[C@H](O[Si](C)(C)C(C)(C)C)C(C)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H39NO6SSi/c1-20-13-15-23(16-14-20)34(29,30)32-18-17-24(33-35(6,7)26(3,4)5)21(2)27-25(28)31-19-22-11-9-8-10-12-22/h8-16,21,24H,17-19H2,1-7H3,(H,27,28)/t21?,24-/m0/s1 |
| InChIKey | CWYOBGOGTGKMEI-FHZUCYEKSA-N |
| XLogP | 5.80 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.75 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|