C23H44O3Si2 — CID 10895167
(4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]oct-7-ynal (PubChem CID 10895167) has the molecular formula C23H44O3Si2 and a molecular weight of 424.77 g/mol. Its IUPAC name is (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]oct-7-ynal.
| Compound Name | (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]oct-7-ynal |
|---|---|
| PubChem CID | 10895167 |
| Molecular Formula | C23H44O3Si2 |
| Molecular Weight | 424.77 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]oct-7-ynal |
| SMILES | C#CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CCC=O)[C@@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O3Si2/c1-13-16-21(26-28(11,12)23(6,7)8)19(17-15-18-24)20(14-2)25-27(9,10)22(3,4)5/h1,14,18-21H,2,15-17H2,3-12H3/t19-,20-,21-/m1/s1 |
| InChIKey | UTDDDCRYKJIRSP-NJDAHSKKSA-N |
| XLogP | 6.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.77 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|