C24H49NO2Si2 — CID 70678065
(3R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-N,N-diethyloct-1-en-7-yn-4-amine (PubChem CID 70678065) has the molecular formula C24H49NO2Si2 and a molecular weight of 439.83 g/mol. Its IUPAC name is (3R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-N,N-diethyloct-1-en-7-yn-4-amine.
| Compound Name | (3R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-N,N-diethyloct-1-en-7-yn-4-amine |
|---|---|
| PubChem CID | 70678065 |
| Molecular Formula | C24H49NO2Si2 |
| Molecular Weight | 439.83 g/mol |
| Exact Mass | 439.33 |
| IUPAC Name | (3R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-N,N-diethyloct-1-en-7-yn-4-amine |
| SMILES | C#CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]([C@@H](C=C)O[Si](C)(C)C(C)(C)C)N(CC)CC |
| InChI | InChI=1S/C24H49NO2Si2/c1-15-19-21(27-29(13,14)24(8,9)10)22(25(17-3)18-4)20(16-2)26-28(11,12)23(5,6)7/h1,16,20-22H,2,17-19H2,3-14H3/t20-,21-,22-/m1/s1 |
| InChIKey | IOBSOMJXLXUOBP-YPAWHYETSA-N |
| XLogP | 6.69 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.83 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|