C26H44O2Si2 — CID 101244819
tert-butyl-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenyl-2-phenylhex-5-ynoxy]-dimethylsilane (PubChem CID 101244819) has the molecular formula C26H44O2Si2 and a molecular weight of 444.81 g/mol. Its IUPAC name is tert-butyl-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenyl-2-phenylhex-5-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenyl-2-phenylhex-5-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101244819 |
| Molecular Formula | C26H44O2Si2 |
| Molecular Weight | 444.81 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | tert-butyl-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenyl-2-phenylhex-5-ynoxy]-dimethylsilane |
| SMILES | C#CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](c1ccccc1)[C@@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H44O2Si2/c1-13-18-23(28-30(11,12)26(6,7)8)24(21-19-16-15-17-20-21)22(14-2)27-29(9,10)25(3,4)5/h1,14-17,19-20,22-24H,2,18H2,3-12H3/t22-,23-,24+/m1/s1 |
| InChIKey | FIVHRKYPBMJXLB-SMIHKQSGSA-N |
| XLogP | 7.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.81 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|