C18H28OSi — CID 139249096
tert-butyl-dimethyl-(1-phenylhex-5-yn-3-yloxy)silane (PubChem CID 139249096) has the molecular formula C18H28OSi and a molecular weight of 288.51 g/mol. Its IUPAC name is tert-butyl-dimethyl-(1-phenylhex-5-yn-3-yloxy)silane.
| Compound Name | tert-butyl-dimethyl-(1-phenylhex-5-yn-3-yloxy)silane |
|---|---|
| PubChem CID | 139249096 |
| Molecular Formula | C18H28OSi |
| Molecular Weight | 288.51 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | tert-butyl-dimethyl-(1-phenylhex-5-yn-3-yloxy)silane |
| SMILES | C#CCC(CCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H28OSi/c1-7-11-17(19-20(5,6)18(2,3)4)15-14-16-12-9-8-10-13-16/h1,8-10,12-13,17H,11,14-15H2,2-6H3 |
| InChIKey | AEWWUWCQUVMCRB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|