C21H32O4Si — CID 138969278
(4R)-4-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylprop-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 138969278) has the molecular formula C21H32O4Si and a molecular weight of 376.57 g/mol. Its IUPAC name is (4R)-4-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylprop-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4R)-4-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylprop-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 138969278 |
| Molecular Formula | C21H32O4Si |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | (4R)-4-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylprop-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | CC1(C)OC[C@](C=O)([C@H](/C=C/c2ccccc2)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C21H32O4Si/c1-19(2,3)26(6,7)24-18(14-13-17-11-9-8-10-12-17)21(15-22)16-23-20(4,5)25-21/h8-15,18H,16H2,1-7H3/b14-13+/t18-,21+/m0/s1 |
| InChIKey | NGPQMYHNVUYIDG-MDFWECQCSA-N |
| XLogP | 4.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|