C19H29IO3Si — CID 50992961
tert-butyl-[(E,1R)-3-iodo-1-[(4S)-4-methyl-2-phenyl-1,3-dioxolan-4-yl]prop-2-enoxy]-dimethylsilane (PubChem CID 50992961) has the molecular formula C19H29IO3Si and a molecular weight of 460.43 g/mol. Its IUPAC name is tert-butyl-[(E,1R)-3-iodo-1-[(4S)-4-methyl-2-phenyl-1,3-dioxolan-4-yl]prop-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,1R)-3-iodo-1-[(4S)-4-methyl-2-phenyl-1,3-dioxolan-4-yl]prop-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 50992961 |
| Molecular Formula | C19H29IO3Si |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | tert-butyl-[(E,1R)-3-iodo-1-[(4S)-4-methyl-2-phenyl-1,3-dioxolan-4-yl]prop-2-enoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](/C=C/I)[C@]1(C)COC(c2ccccc2)O1 |
| InChI | InChI=1S/C19H29IO3Si/c1-18(2,3)24(5,6)23-16(12-13-20)19(4)14-21-17(22-19)15-10-8-7-9-11-15/h7-13,16-17H,14H2,1-6H3/b13-12+/t16-,17?,19+/m1/s1 |
| InChIKey | SGYCEMAFLUIGGJ-LOVLXKELSA-N |
| XLogP | 5.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|