C24H36O5Si — CID 24755714
[(1R,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]but-3-en-2-yl] prop-2-enoate (PubChem CID 24755714) has the molecular formula C24H36O5Si and a molecular weight of 432.63 g/mol. Its IUPAC name is [(1R,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]but-3-en-2-yl] prop-2-enoate.
| Compound Name | [(1R,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]but-3-en-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 24755714 |
| Molecular Formula | C24H36O5Si |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | [(1R,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]but-3-en-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@@H](C=C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H36O5Si/c1-10-18(26-19(25)11-2)21(29-30(8,9)23(3,4)5)22-20(27-24(6,7)28-22)17-15-13-12-14-16-17/h10-16,18,20-22H,1-2H2,3-9H3/t18-,20-,21+,22+/m0/s1 |
| InChIKey | ILWIHVAEMDSYHR-VXSCBNMQSA-N |
| XLogP | 5.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|