C30H46O5Si — CID 132553674
[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(4S,6R)-2,2-dimethyl-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]hept-1-en-4-yl] prop-2-enoate (PubChem CID 132553674) has the molecular formula C30H46O5Si and a molecular weight of 514.78 g/mol. Its IUPAC name is [(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(4S,6R)-2,2-dimethyl-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]hept-1-en-4-yl] prop-2-enoate.
| Compound Name | [(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(4S,6R)-2,2-dimethyl-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]hept-1-en-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 132553674 |
| Molecular Formula | C30H46O5Si |
| Molecular Weight | 514.78 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | [(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(4S,6R)-2,2-dimethyl-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]hept-1-en-4-yl] prop-2-enoate |
| SMILES | C=CC[C@H](C[C@@H](C[C@@H]1C[C@H](/C=C/c2ccccc2)OC(C)(C)O1)O[Si](C)(C)C(C)(C)C)OC(=O)C=C |
| InChI | InChI=1S/C30H46O5Si/c1-10-15-24(32-28(31)11-2)20-27(35-36(8,9)29(3,4)5)22-26-21-25(33-30(6,7)34-26)19-18-23-16-13-12-14-17-23/h10-14,16-19,24-27H,1-2,15,20-22H2,3-9H3/b19-18+/t24-,25+,26+,27+/m1/s1 |
| InChIKey | FCTHXZBNNRAFBG-NIGOOMSGSA-N |
| XLogP | 7.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.78 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|