C27H44O3Si — CID 11247788
tert-butyl-[(4R,5E)-7-[(4S,6S)-2,2-dimethyl-6-(2-phenylethyl)-1,3-dioxan-4-yl]hepta-1,5-dien-4-yl]oxy-dimethylsilane (PubChem CID 11247788) has the molecular formula C27H44O3Si and a molecular weight of 444.73 g/mol. Its IUPAC name is tert-butyl-[(4R,5E)-7-[(4S,6S)-2,2-dimethyl-6-(2-phenylethyl)-1,3-dioxan-4-yl]hepta-1,5-dien-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4R,5E)-7-[(4S,6S)-2,2-dimethyl-6-(2-phenylethyl)-1,3-dioxan-4-yl]hepta-1,5-dien-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11247788 |
| Molecular Formula | C27H44O3Si |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | tert-butyl-[(4R,5E)-7-[(4S,6S)-2,2-dimethyl-6-(2-phenylethyl)-1,3-dioxan-4-yl]hepta-1,5-dien-4-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@H](/C=C/C[C@H]1C[C@H](CCc2ccccc2)OC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H44O3Si/c1-9-14-23(30-31(7,8)26(2,3)4)17-13-18-24-21-25(29-27(5,6)28-24)20-19-22-15-11-10-12-16-22/h9-13,15-17,23-25H,1,14,18-21H2,2-8H3/b17-13+/t23-,24+,25+/m1/s1 |
| InChIKey | WYSZMNNQRGAEAS-KEJJPIJTSA-N |
| XLogP | 7.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|