C37H54O4Si — CID 11467432
tert-butyl-[(2S)-1-[(4R,6S)-2,2-dimethyl-6-[[(2R,3S,6S)-3-methyl-6-prop-2-enyloxan-2-yl]methyl]-1,3-dioxan-4-yl]pent-4-en-2-yl]oxy-diphenylsilane (PubChem CID 11467432) has the molecular formula C37H54O4Si and a molecular weight of 590.92 g/mol. Its IUPAC name is tert-butyl-[(2S)-1-[(4R,6S)-2,2-dimethyl-6-[[(2R,3S,6S)-3-methyl-6-prop-2-enyloxan-2-yl]methyl]-1,3-dioxan-4-yl]pent-4-en-2-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2S)-1-[(4R,6S)-2,2-dimethyl-6-[[(2R,3S,6S)-3-methyl-6-prop-2-enyloxan-2-yl]methyl]-1,3-dioxan-4-yl]pent-4-en-2-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 11467432 |
| Molecular Formula | C37H54O4Si |
| Molecular Weight | 590.92 g/mol |
| Exact Mass | 590.38 |
| IUPAC Name | tert-butyl-[(2S)-1-[(4R,6S)-2,2-dimethyl-6-[[(2R,3S,6S)-3-methyl-6-prop-2-enyloxan-2-yl]methyl]-1,3-dioxan-4-yl]pent-4-en-2-yl]oxy-diphenylsilane |
| SMILES | C=CC[C@@H]1CC[C@H](C)[C@@H](C[C@@H]2C[C@H](C[C@H](CC=C)O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)OC(C)(C)O2)O1 |
| InChI | InChI=1S/C37H54O4Si/c1-9-17-29-24-23-28(3)35(38-29)27-32-26-31(39-37(7,8)40-32)25-30(18-10-2)41-42(36(4,5)6,33-19-13-11-14-20-33)34-21-15-12-16-22-34/h9-16,19-22,28-32,35H,1-2,17-18,23-27H2,3-8H3/t28-,29+,30-,31-,32-,35+/m0/s1 |
| InChIKey | RBWUJAQKOYAVFC-RPKZYHJXSA-N |
| XLogP | 7.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.92 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|