C32H46O2S2Si — CID 25258627
tert-butyl-[2-[(2R,3S,6S)-3-methyl-6-[[2-[(E)-prop-1-enyl]-1,3-dithian-2-yl]methyl]oxan-2-yl]ethoxy]-diphenylsilane (PubChem CID 25258627) has the molecular formula C32H46O2S2Si and a molecular weight of 554.94 g/mol. Its IUPAC name is tert-butyl-[2-[(2R,3S,6S)-3-methyl-6-[[2-[(E)-prop-1-enyl]-1,3-dithian-2-yl]methyl]oxan-2-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(2R,3S,6S)-3-methyl-6-[[2-[(E)-prop-1-enyl]-1,3-dithian-2-yl]methyl]oxan-2-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 25258627 |
| Molecular Formula | C32H46O2S2Si |
| Molecular Weight | 554.94 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | tert-butyl-[2-[(2R,3S,6S)-3-methyl-6-[[2-[(E)-prop-1-enyl]-1,3-dithian-2-yl]methyl]oxan-2-yl]ethoxy]-diphenylsilane |
| SMILES | C/C=C/C1(C[C@@H]2CC[C@H](C)[C@@H](CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)SCCCS1 |
| InChI | InChI=1S/C32H46O2S2Si/c1-6-21-32(35-23-13-24-36-32)25-27-19-18-26(2)30(34-27)20-22-33-37(31(3,4)5,28-14-9-7-10-15-28)29-16-11-8-12-17-29/h6-12,14-17,21,26-27,30H,13,18-20,22-25H2,1-5H3/b21-6+/t26-,27-,30+/m0/s1 |
| InChIKey | HNUIZIWSVZBQBA-YGHVTUKXSA-N |
| XLogP | 7.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.94 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|