C30H42O5Si — CID 102376061
ethyl (E)-3-[(4R,5S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]prop-2-enoate (PubChem CID 102376061) has the molecular formula C30H42O5Si and a molecular weight of 510.75 g/mol. Its IUPAC name is ethyl (E)-3-[(4R,5S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(4R,5S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 102376061 |
| Molecular Formula | C30H42O5Si |
| Molecular Weight | 510.75 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | ethyl (E)-3-[(4R,5S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1OC(C)(C)O[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C30H42O5Si/c1-8-32-28(31)20-19-26-23(2)27(35-30(6,7)34-26)21-22-33-36(29(3,4)5,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-20,23,26-27H,8,21-22H2,1-7H3/b20-19+/t23-,26-,27-/m1/s1 |
| InChIKey | BXJIXKHZNRHHCS-OHLGPGSTSA-N |
| XLogP | 5.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.75 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|