C24H26O3 — CID 166448783
(E)-4-[(4S,6S)-2,2-dimethyl-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]-1-phenylbut-2-en-1-one (PubChem CID 166448783) has the molecular formula C24H26O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is (E)-4-[(4S,6S)-2,2-dimethyl-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]-1-phenylbut-2-en-1-one.
| Compound Name | (E)-4-[(4S,6S)-2,2-dimethyl-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]-1-phenylbut-2-en-1-one |
|---|---|
| PubChem CID | 166448783 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (E)-4-[(4S,6S)-2,2-dimethyl-6-[(E)-2-phenylethenyl]-1,3-dioxan-4-yl]-1-phenylbut-2-en-1-one |
| SMILES | CC1(C)O[C@@H](C/C=C/C(=O)c2ccccc2)C[C@@H](/C=C/c2ccccc2)O1 |
| InChI | InChI=1S/C24H26O3/c1-24(2)26-21(14-9-15-23(25)20-12-7-4-8-13-20)18-22(27-24)17-16-19-10-5-3-6-11-19/h3-13,15-17,21-22H,14,18H2,1-2H3/b15-9+,17-16+/t21-,22+/m0/s1 |
| InChIKey | NMHDOWNSBDEBMC-VYGGXQPHSA-N |
| XLogP | 5.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|